C21H18ClF6NO3S — CID 122678550
2-[9b-(3-chlorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indol-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 122678550) has the molecular formula C21H18ClF6NO3S and a molecular weight of 513.89 g/mol. Its IUPAC name is 2-[9b-(3-chlorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indol-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[9b-(3-chlorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indol-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 122678550 |
| Molecular Formula | C21H18ClF6NO3S |
| Molecular Weight | 513.89 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 2-[9b-(3-chlorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indol-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=S(=O)(c1cccc(Cl)c1)C12CCNC1CCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C21H18ClF6NO3S/c22-14-2-1-3-15(11-14)33(31,32)18-8-9-29-17(18)7-4-12-10-13(5-6-16(12)18)19(30,20(23,24)25)21(26,27)28/h1-3,5-6,10-11,17,29-30H,4,7-9H2 |
| InChIKey | WPGRGCQUMYDSBP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |