C22H23Cl2F4N — CID 169426184
9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride (PubChem CID 169426184) has the molecular formula C22H23Cl2F4N and a molecular weight of 448.33 g/mol. Its IUPAC name is 9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride.
| Compound Name | 9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride |
|---|---|
| PubChem CID | 169426184 |
| Molecular Formula | C22H23Cl2F4N |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 9b-[(4-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride |
| SMILES | CC(F)(c1ccc2c(c1)CCC1NCCC21Cc1ccc(Cl)cc1)C(F)(F)F.Cl |
| InChI | InChI=1S/C22H22ClF4N.ClH/c1-20(24,22(25,26)27)16-5-8-18-15(12-16)4-9-19-21(18,10-11-28-19)13-14-2-6-17(23)7-3-14;/h2-3,5-8,12,19,28H,4,9-11,13H2,1H3;1H |
| InChIKey | GNIOFAQPYKTLRC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |