C21H31N3O — CID 134490331
(4-anilino-3-methylphenyl)-[3-(diethylamino)propylamino]methanol (PubChem CID 134490331) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (4-anilino-3-methylphenyl)-[3-(diethylamino)propylamino]methanol.
| Compound Name | (4-anilino-3-methylphenyl)-[3-(diethylamino)propylamino]methanol |
|---|---|
| PubChem CID | 134490331 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (4-anilino-3-methylphenyl)-[3-(diethylamino)propylamino]methanol |
| SMILES | CCN(CC)CCCNC(O)c1ccc(Nc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H31N3O/c1-4-24(5-2)15-9-14-22-21(25)18-12-13-20(17(3)16-18)23-19-10-7-6-8-11-19/h6-8,10-13,16,21-23,25H,4-5,9,14-15H2,1-3H3 |
| InChIKey | CPUNDBSRHRLTPP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|