C22H21N3O2 — CID 134492881
7-[6-[3-(methoxymethyl)cyclobutyl]oxy-3-pyridinyl]-5H-pyrido[4,3-b]indole (PubChem CID 134492881) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 7-[6-[3-(methoxymethyl)cyclobutyl]oxy-3-pyridinyl]-5H-pyrido[4,3-b]indole.
| Compound Name | 7-[6-[3-(methoxymethyl)cyclobutyl]oxy-3-pyridinyl]-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134492881 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 7-[6-[3-(methoxymethyl)cyclobutyl]oxy-3-pyridinyl]-5H-pyrido[4,3-b]indole |
| SMILES | COCC1CC(Oc2ccc(-c3ccc4c(c3)[nH]c3ccncc34)cn2)C1 |
| InChI | InChI=1S/C22H21N3O2/c1-26-13-14-8-17(9-14)27-22-5-3-16(11-24-22)15-2-4-18-19-12-23-7-6-20(19)25-21(18)10-15/h2-7,10-12,14,17,25H,8-9,13H2,1H3 |
| InChIKey | SAJQAWMZCNMHDK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |