C14H14N2O4 — CID 134494482
4-(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)benzoic acid (PubChem CID 134494482) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)benzoic acid.
| Compound Name | 4-(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 134494482 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-(4-cyclobutyl-2,5-dioxoimidazolidin-4-yl)benzoic acid |
| SMILES | O=C1NC(=O)C(c2ccc(C(=O)O)cc2)(C2CCC2)N1 |
| InChI | InChI=1S/C14H14N2O4/c17-11(18)8-4-6-10(7-5-8)14(9-2-1-3-9)12(19)15-13(20)16-14/h4-7,9H,1-3H2,(H,17,18)(H2,15,16,19,20) |
| InChIKey | FYITYSJDGTZEML-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|