C14H16N2O4 — CID 54049258
4-(4-butyl-2,5-dioxoimidazolidin-4-yl)benzoic acid (PubChem CID 54049258) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-(4-butyl-2,5-dioxoimidazolidin-4-yl)benzoic acid.
| Compound Name | 4-(4-butyl-2,5-dioxoimidazolidin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 54049258 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-(4-butyl-2,5-dioxoimidazolidin-4-yl)benzoic acid |
| SMILES | CCCCC1(c2ccc(C(=O)O)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C14H16N2O4/c1-2-3-8-14(12(19)15-13(20)16-14)10-6-4-9(5-7-10)11(17)18/h4-7H,2-3,8H2,1H3,(H,17,18)(H2,15,16,19,20) |
| InChIKey | LRSWFLXPFBJIBC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|