C23H36N4O3 — CID 46227827
2-(diethylamino)-N-[4-(4-hexyl-2,5-dioxoimidazolidin-4-yl)-2,6-dimethylphenyl]acetamide (PubChem CID 46227827) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-(diethylamino)-N-[4-(4-hexyl-2,5-dioxoimidazolidin-4-yl)-2,6-dimethylphenyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[4-(4-hexyl-2,5-dioxoimidazolidin-4-yl)-2,6-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 46227827 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 2-(diethylamino)-N-[4-(4-hexyl-2,5-dioxoimidazolidin-4-yl)-2,6-dimethylphenyl]acetamide |
| SMILES | CCCCCCC1(c2cc(C)c(NC(=O)CN(CC)CC)c(C)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H36N4O3/c1-6-9-10-11-12-23(21(29)25-22(30)26-23)18-13-16(4)20(17(5)14-18)24-19(28)15-27(7-2)8-3/h13-14H,6-12,15H2,1-5H3,(H,24,28)(H2,25,26,29,30) |
| InChIKey | ZVIGPYCYZQFMAK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|