C20H24N6O8 — CID 134495372
3-[[(3-amino-3-oxopropyl)-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanamide (PubChem CID 134495372) has the molecular formula C20H24N6O8 and a molecular weight of 476.45 g/mol. Its IUPAC name is 3-[[(3-amino-3-oxopropyl)-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanamide.
| Compound Name | 3-[[(3-amino-3-oxopropyl)-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanamide |
|---|---|
| PubChem CID | 134495372 |
| Molecular Formula | C20H24N6O8 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-[[(3-amino-3-oxopropyl)-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanamide |
| SMILES | NC(=O)CCN(C(=O)CCN1C(=O)C=CC1=O)N(CCC(N)=O)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H24N6O8/c21-13(27)5-11-25(19(33)7-9-23-15(29)1-2-16(23)30)26(12-6-14(22)28)20(34)8-10-24-17(31)3-4-18(24)32/h1-4H,5-12H2,(H2,21,27)(H2,22,28) |
| InChIKey | YFMFIMAYAHVRAA-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 201.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|