C25H30N4 — CID 134502531
N-cyclohexyl-4-[2-methylidene-1-[2-(3-methylphenyl)ethyl]-4-pyridinyl]pyrimidin-2-amine (PubChem CID 134502531) has the molecular formula C25H30N4 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-methylidene-1-[2-(3-methylphenyl)ethyl]-4-pyridinyl]pyrimidin-2-amine.
| Compound Name | N-cyclohexyl-4-[2-methylidene-1-[2-(3-methylphenyl)ethyl]-4-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134502531 |
| Molecular Formula | C25H30N4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | N-cyclohexyl-4-[2-methylidene-1-[2-(3-methylphenyl)ethyl]-4-pyridinyl]pyrimidin-2-amine |
| SMILES | C=C1C=C(c2ccnc(NC3CCCCC3)n2)C=CN1CCc1cccc(C)c1 |
| InChI | InChI=1S/C25H30N4/c1-19-7-6-8-21(17-19)12-15-29-16-13-22(18-20(29)2)24-11-14-26-25(28-24)27-23-9-4-3-5-10-23/h6-8,11,13-14,16-18,23H,2-5,9-10,12,15H2,1H3,(H,26,27,28) |
| InChIKey | SQRFFDFSZZKZMN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |