C29H39FN4 — CID 134502538
N-(3,3-dimethylcyclohexyl)-4-[(1Z,3E)-1-[1-(3-fluoro-4-methylphenyl)propyl-methylamino]hexa-1,3,5-trien-3-yl]pyrimidin-2-amine (PubChem CID 134502538) has the molecular formula C29H39FN4 and a molecular weight of 462.66 g/mol. Its IUPAC name is N-(3,3-dimethylcyclohexyl)-4-[(1Z,3E)-1-[1-(3-fluoro-4-methylphenyl)propyl-methylamino]hexa-1,3,5-trien-3-yl]pyrimidin-2-amine.
| Compound Name | N-(3,3-dimethylcyclohexyl)-4-[(1Z,3E)-1-[1-(3-fluoro-4-methylphenyl)propyl-methylamino]hexa-1,3,5-trien-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134502538 |
| Molecular Formula | C29H39FN4 |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | N-(3,3-dimethylcyclohexyl)-4-[(1Z,3E)-1-[1-(3-fluoro-4-methylphenyl)propyl-methylamino]hexa-1,3,5-trien-3-yl]pyrimidin-2-amine |
| SMILES | C=C/C=C(\C=C/N(C)C(CC)c1ccc(C)c(F)c1)c1ccnc(NC2CCCC(C)(C)C2)n1 |
| InChI | InChI=1S/C29H39FN4/c1-7-10-22(15-18-34(6)27(8-2)23-13-12-21(3)25(30)19-23)26-14-17-31-28(33-26)32-24-11-9-16-29(4,5)20-24/h7,10,12-15,17-19,24,27H,1,8-9,11,16,20H2,2-6H3,(H,31,32,33)/b18-15-,22-10+ |
| InChIKey | XLDPESODZVMFTL-PSVPKSOVSA-N |
| XLogP | 7.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|