C20H18F2N4O — CID 134503941
4-(3-aminopyrazin-2-yl)-N-[(3-ethyl-5-fluorophenyl)methyl]-2-fluorobenzamide (PubChem CID 134503941) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-(3-aminopyrazin-2-yl)-N-[(3-ethyl-5-fluorophenyl)methyl]-2-fluorobenzamide.
| Compound Name | 4-(3-aminopyrazin-2-yl)-N-[(3-ethyl-5-fluorophenyl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 134503941 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-(3-aminopyrazin-2-yl)-N-[(3-ethyl-5-fluorophenyl)methyl]-2-fluorobenzamide |
| SMILES | CCc1cc(F)cc(CNC(=O)c2ccc(-c3nccnc3N)cc2F)c1 |
| InChI | InChI=1S/C20H18F2N4O/c1-2-12-7-13(9-15(21)8-12)11-26-20(27)16-4-3-14(10-17(16)22)18-19(23)25-6-5-24-18/h3-10H,2,11H2,1H3,(H2,23,25)(H,26,27) |
| InChIKey | SQLBUFCAGBOROU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |