C22H22N6O2 — CID 134507914
5-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]-3-piperidin-3-yloxypyridine-2-carbonitrile (PubChem CID 134507914) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 5-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]-3-piperidin-3-yloxypyridine-2-carbonitrile.
| Compound Name | 5-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]-3-piperidin-3-yloxypyridine-2-carbonitrile |
|---|---|
| PubChem CID | 134507914 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 5-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]-3-piperidin-3-yloxypyridine-2-carbonitrile |
| SMILES | COc1ccc(-c2cnc(Nc3cnc(C#N)c(OC4CCCNC4)c3)nc2)cc1 |
| InChI | InChI=1S/C22H22N6O2/c1-29-18-6-4-15(5-7-18)16-11-26-22(27-12-16)28-17-9-21(20(10-23)25-13-17)30-19-3-2-8-24-14-19/h4-7,9,11-13,19,24H,2-3,8,14H2,1H3,(H,26,27,28) |
| InChIKey | OTJTWBJJUCIKRL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |