C13H15N — CID 134513277
5-but-1-en-2-yl-2,4-dimethylbenzonitrile (PubChem CID 134513277) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-but-1-en-2-yl-2,4-dimethylbenzonitrile.
| Compound Name | 5-but-1-en-2-yl-2,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 134513277 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-but-1-en-2-yl-2,4-dimethylbenzonitrile |
| SMILES | C=C(CC)c1cc(C#N)c(C)cc1C |
| InChI | InChI=1S/C13H15N/c1-5-9(2)13-7-12(8-14)10(3)6-11(13)4/h6-7H,2,5H2,1,3-4H3 |
| InChIKey | OFAMOFHXPUJALL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |