About 5-but-1-en-2-yl-2,4-dimethylbenzonitrile
5-but-1-en-2-yl-2,4-dimethylbenzonitrile (PubChem CID 134513277) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-but-1-en-2-yl-2,4-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 5-but-1-en-2-yl-2,4-dimethylbenzonitrile |
| PubChem CID | 134513277 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-but-1-en-2-yl-2,4-dimethylbenzonitrile |
| SMILES | C=C(CC)c1cc(C#N)c(C)cc1C |
| InChI | InChI=1S/C13H15N/c1-5-9(2)13-7-12(8-14)10(3)6-11(13)4/h6-7H,2,5H2,1,3-4H3 |
| InChIKey | OFAMOFHXPUJALL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-but-1-en-2-yl-2,4-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-1-en-2-yl-2,4-dimethylbenzonitrile?
The IUPAC name of 5-but-1-en-2-yl-2,4-dimethylbenzonitrile (CID 134513277) is 5-but-1-en-2-yl-2,4-dimethylbenzonitrile.
What is the SMILES notation for 5-but-1-en-2-yl-2,4-dimethylbenzonitrile?
The canonical SMILES for 5-but-1-en-2-yl-2,4-dimethylbenzonitrile is C=C(CC)c1cc(C#N)c(C)cc1C.
What is the InChIKey of 5-but-1-en-2-yl-2,4-dimethylbenzonitrile?
The InChIKey is OFAMOFHXPUJALL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-5-9(2)13-7-12(8-14)10(3)6-11(13)4/h6-7H,2,5H2,1,3-4H3.
What are the key properties of 5-but-1-en-2-yl-2,4-dimethylbenzonitrile?
5-but-1-en-2-yl-2,4-dimethylbenzonitrile has a molecular weight of 185.27 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-1-en-2-yl-2,4-dimethylbenzonitrile is sourced from PubChem (CID 134513277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).