C19H18F2N2 — CID 142503046
5-[(E)-1-(3-amino-2,6-difluorophenyl)but-1-enyl]-2,4-dimethylbenzonitrile (PubChem CID 142503046) has the molecular formula C19H18F2N2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 5-[(E)-1-(3-amino-2,6-difluorophenyl)but-1-enyl]-2,4-dimethylbenzonitrile.
| Compound Name | 5-[(E)-1-(3-amino-2,6-difluorophenyl)but-1-enyl]-2,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 142503046 |
| Molecular Formula | C19H18F2N2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-[(E)-1-(3-amino-2,6-difluorophenyl)but-1-enyl]-2,4-dimethylbenzonitrile |
| SMILES | CC/C=C(\c1cc(C#N)c(C)cc1C)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C19H18F2N2/c1-4-5-14(18-16(20)6-7-17(23)19(18)21)15-9-13(10-22)11(2)8-12(15)3/h5-9H,4,23H2,1-3H3/b14-5+ |
| InChIKey | OHWUDZFGGDWSII-LHHJGKSTSA-N |
| XLogP | 4.88 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|