C20H37NO — CID 134513454
(Z,5R)-6-(4-tert-butylcyclohexyl)oxy-5-ethyl-5-methylhept-2-en-4-imine (PubChem CID 134513454) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is (Z,5R)-6-(4-tert-butylcyclohexyl)oxy-5-ethyl-5-methylhept-2-en-4-imine.
| Compound Name | (Z,5R)-6-(4-tert-butylcyclohexyl)oxy-5-ethyl-5-methylhept-2-en-4-imine |
|---|---|
| PubChem CID | 134513454 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (Z,5R)-6-(4-tert-butylcyclohexyl)oxy-5-ethyl-5-methylhept-2-en-4-imine |
| SMILES | [H]/N=C(\C=C/C)[C@@](C)(CC)C(C)OC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H37NO/c1-8-10-18(21)20(7,9-2)15(3)22-17-13-11-16(12-14-17)19(4,5)6/h8,10,15-17,21H,9,11-14H2,1-7H3/b10-8-,21-18+/t15?,16?,17?,20-/m0/s1 |
| InChIKey | KENBSUUTZBHDKB-HEVCZCIRSA-N |
| XLogP | 6.01 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|