C11H22N2 — CID 20592811
4-tert-butylcyclohexane-1-carboximidamide (PubChem CID 20592811) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 4-tert-butylcyclohexane-1-carboximidamide.
| Compound Name | 4-tert-butylcyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 20592811 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 4-tert-butylcyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H22N2/c1-11(2,3)9-6-4-8(5-7-9)10(12)13/h8-9H,4-7H2,1-3H3,(H3,12,13) |
| InChIKey | AEMXQJFRFAAWJM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|