C7H12F2N2 — CID 83854458
4,4-difluorocyclohexane-1-carboximidamide (PubChem CID 83854458) has the molecular formula C7H12F2N2 and a molecular weight of 162.18 g/mol. Its IUPAC name is 4,4-difluorocyclohexane-1-carboximidamide.
| Compound Name | 4,4-difluorocyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 83854458 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 4,4-difluorocyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H12F2N2/c8-7(9)3-1-5(2-4-7)6(10)11/h5H,1-4H2,(H3,10,11) |
| InChIKey | LXDHYJRASRJPSY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|