C7H14N4 — CID 175323510
3,3-dimethylcyclopropane-1,2-dicarboximidamide (PubChem CID 175323510) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 3,3-dimethylcyclopropane-1,2-dicarboximidamide.
| Compound Name | 3,3-dimethylcyclopropane-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 175323510 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 3,3-dimethylcyclopropane-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)C1C(/C(N)=N/[H])C1(C)C |
| InChI | InChI=1S/C7H14N4/c1-7(2)3(5(8)9)4(7)6(10)11/h3-4H,1-2H3,(H3,8,9)(H3,10,11) |
| InChIKey | OEERGDWODWYWKB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|