C9H18N2 — CID 64740369
3,4-dimethylcyclohexane-1-carboximidamide (PubChem CID 64740369) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 3,4-dimethylcyclohexane-1-carboximidamide.
| Compound Name | 3,4-dimethylcyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 64740369 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3,4-dimethylcyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C9H18N2/c1-6-3-4-8(9(10)11)5-7(6)2/h6-8H,3-5H2,1-2H3,(H3,10,11) |
| InChIKey | QUKWBHGSCDTGBO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|