C21H29NO4 — CID 134513804
tert-butyl 4-[(5-methoxycarbonyl-2,4-dimethylphenyl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134513804) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl 4-[(5-methoxycarbonyl-2,4-dimethylphenyl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-methoxycarbonyl-2,4-dimethylphenyl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134513804 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl 4-[(5-methoxycarbonyl-2,4-dimethylphenyl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)c1cc(CC2=CCN(C(=O)OC(C)(C)C)CC2)c(C)cc1C |
| InChI | InChI=1S/C21H29NO4/c1-14-11-15(2)18(19(23)25-6)13-17(14)12-16-7-9-22(10-8-16)20(24)26-21(3,4)5/h7,11,13H,8-10,12H2,1-6H3 |
| InChIKey | GPSGOIQJPCHWOK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|