About N-(2-fluoropropyl)-N'-methylethanimidamide
N-(2-fluoropropyl)-N'-methylethanimidamide (PubChem CID 134514341) has the molecular formula C6H13FN2
and a molecular weight of 132.18 g/mol. Its IUPAC name is N-(2-fluoropropyl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-(2-fluoropropyl)-N'-methylethanimidamide |
| PubChem CID | 134514341 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | N-(2-fluoropropyl)-N'-methylethanimidamide |
| SMILES | C/N=C(\C)NCC(C)F |
| InChI | InChI=1S/C6H13FN2/c1-5(7)4-9-6(2)8-3/h5H,4H2,1-3H3,(H,8,9) |
| InChIKey | JGXXFQRDDCJVPZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluoropropyl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoropropyl)-N'-methylethanimidamide?
The IUPAC name of N-(2-fluoropropyl)-N'-methylethanimidamide (CID 134514341) is N-(2-fluoropropyl)-N'-methylethanimidamide.
What is the SMILES notation for N-(2-fluoropropyl)-N'-methylethanimidamide?
The canonical SMILES for N-(2-fluoropropyl)-N'-methylethanimidamide is C/N=C(\C)NCC(C)F.
What is the InChIKey of N-(2-fluoropropyl)-N'-methylethanimidamide?
The InChIKey is JGXXFQRDDCJVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FN2/c1-5(7)4-9-6(2)8-3/h5H,4H2,1-3H3,(H,8,9).
What are the key properties of N-(2-fluoropropyl)-N'-methylethanimidamide?
N-(2-fluoropropyl)-N'-methylethanimidamide has a molecular weight of 132.18 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoropropyl)-N'-methylethanimidamide is sourced from PubChem (CID 134514341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).