C21H17F2N3O — CID 134514590
(5S)-10-amino-9-fluoro-7-(4-fluorophenyl)-2,5-dimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one (PubChem CID 134514590) has the molecular formula C21H17F2N3O and a molecular weight of 365.38 g/mol. Its IUPAC name is (5S)-10-amino-9-fluoro-7-(4-fluorophenyl)-2,5-dimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one.
| Compound Name | (5S)-10-amino-9-fluoro-7-(4-fluorophenyl)-2,5-dimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one |
|---|---|
| PubChem CID | 134514590 |
| Molecular Formula | C21H17F2N3O |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (5S)-10-amino-9-fluoro-7-(4-fluorophenyl)-2,5-dimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one |
| SMILES | C[C@@H]1N=C(c2ccc(F)cc2)c2cc(F)c(N)cc2-c2cn(C)c(=O)cc21 |
| InChI | InChI=1S/C21H17F2N3O/c1-11-14-9-20(27)26(2)10-17(14)15-8-19(24)18(23)7-16(15)21(25-11)12-3-5-13(22)6-4-12/h3-11H,24H2,1-2H3/t11-/m0/s1 |
| InChIKey | OZERNIRSQPEPKJ-NSHDSACASA-N |
| XLogP | 3.82 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|