C25H23ClFN3O3S — CID 139484853
(5S)-9-chloro-5-cyclopropyl-7-(4-fluorophenyl)-2-methyl-3-oxo-10-[2-(sulfinoamino)ethyl]-5H-pyrido[4,3-d][2]benzazepine (PubChem CID 139484853) has the molecular formula C25H23ClFN3O3S and a molecular weight of 500.00 g/mol. Its IUPAC name is (5S)-9-chloro-5-cyclopropyl-7-(4-fluorophenyl)-2-methyl-3-oxo-10-[2-(sulfinoamino)ethyl]-5H-pyrido[4,3-d][2]benzazepine.
| Compound Name | (5S)-9-chloro-5-cyclopropyl-7-(4-fluorophenyl)-2-methyl-3-oxo-10-[2-(sulfinoamino)ethyl]-5H-pyrido[4,3-d][2]benzazepine |
|---|---|
| PubChem CID | 139484853 |
| Molecular Formula | C25H23ClFN3O3S |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (5S)-9-chloro-5-cyclopropyl-7-(4-fluorophenyl)-2-methyl-3-oxo-10-[2-(sulfinoamino)ethyl]-5H-pyrido[4,3-d][2]benzazepine |
| SMILES | Cn1cc2c(cc1=O)[C@H](C1CC1)N=C(c1ccc(F)cc1)c1cc(Cl)c(CCNS(=O)O)cc1-2 |
| InChI | InChI=1S/C25H23ClFN3O3S/c1-30-13-21-18-10-16(8-9-28-34(32)33)22(26)11-19(18)24(15-4-6-17(27)7-5-15)29-25(14-2-3-14)20(21)12-23(30)31/h4-7,10-14,25,28H,2-3,8-9H2,1H3,(H,32,33)/t25-/m0/s1 |
| InChIKey | IACBFJKSEDKEMS-VWLOTQADSA-N |
| XLogP | 4.42 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|