C17H34N4O2 — CID 134515019
propan-2-yl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-methylpiperidin-4-yl]carbamate (PubChem CID 134515019) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is propan-2-yl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-methylpiperidin-4-yl]carbamate.
| Compound Name | propan-2-yl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 134515019 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | propan-2-yl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-methylpiperidin-4-yl]carbamate |
| SMILES | CCN1CCN(CC2(NC(=O)OC(C)C)CCN(C)CC2)CC1 |
| InChI | InChI=1S/C17H34N4O2/c1-5-20-10-12-21(13-11-20)14-17(6-8-19(4)9-7-17)18-16(22)23-15(2)3/h15H,5-14H2,1-4H3,(H,18,22) |
| InChIKey | JBOLNWSRHJGPLG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |