C25H36F12N4O6 — CID 161303825
1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-4-methylpiperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (PubChem CID 161303825) has the molecular formula C25H36F12N4O6 and a molecular weight of 716.56 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-4-methylpiperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-4-methylpiperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161303825 |
| Molecular Formula | C25H36F12N4O6 |
| Molecular Weight | 716.56 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-4-methylpiperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| SMILES | CC1(N)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1.CC1(NC(=O)OC(C)(C)C)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H22F6N2O4.C10H14F6N2O2/c1-12(2,3)27-10(24)22-13(4)5-7-23(8-6-13)11(25)26-9(14(16,17)18)15(19,20)21;1-8(17)2-4-18(5-3-8)7(19)20-6(9(11,12)13)10(14,15)16/h9H,5-8H2,1-4H3,(H,22,24);6H,2-5,17H2,1H3 |
| InChIKey | VHYYXXQGYNUBIA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|