C29H46F12N4O7 — CID 161390819
tert-butyl N-(4-methylpiperidin-4-yl)carbamate;1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (PubChem CID 161390819) has the molecular formula C29H46F12N4O7 and a molecular weight of 790.68 g/mol. Its IUPAC name is tert-butyl N-(4-methylpiperidin-4-yl)carbamate;1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl N-(4-methylpiperidin-4-yl)carbamate;1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161390819 |
| Molecular Formula | C29H46F12N4O7 |
| Molecular Weight | 790.68 g/mol |
| Exact Mass | 790.32 |
| IUPAC Name | tert-butyl N-(4-methylpiperidin-4-yl)carbamate;1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1.CC1(NC(=O)OC(C)(C)C)CCNCC1.OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22F6N2O4.C11H22N2O2.C3H2F6O/c1-12(2,3)27-10(24)22-13(4)5-7-23(8-6-13)11(25)26-9(14(16,17)18)15(19,20)21;1-10(2,3)15-9(14)13-11(4)5-7-12-8-6-11;4-2(5,6)1(10)3(7,8)9/h9H,5-8H2,1-4H3,(H,22,24);12H,5-8H2,1-4H3,(H,13,14);1,10H |
| InChIKey | VSYQWZXCBDLTPC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|