C27H40F12N4O6 — CID 162239297
1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-(methylamino)piperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate (PubChem CID 162239297) has the molecular formula C27H40F12N4O6 and a molecular weight of 744.61 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-(methylamino)piperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-(methylamino)piperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162239297 |
| Molecular Formula | C27H40F12N4O6 |
| Molecular Weight | 744.61 g/mol |
| Exact Mass | 744.28 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-(methylamino)piperidine-1-carboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate |
| SMILES | CN(C(=O)OC(C)(C)C)C1(C)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1.CNC1(C)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H24F6N2O4.C11H16F6N2O2/c1-13(2,3)28-11(25)23(5)14(4)6-8-24(9-7-14)12(26)27-10(15(17,18)19)16(20,21)22;1-9(18-2)3-5-19(6-4-9)8(20)21-7(10(12,13)14)11(15,16)17/h10H,6-9H2,1-5H3;7,18H,3-6H2,1-2H3 |
| InChIKey | ZWMGYTGZIJINRJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|