C10H22N2OS2 — CID 134517104
1-[2-(2-methoxyethyldisulfanyl)ethyl]-4-methylpiperazine (PubChem CID 134517104) has the molecular formula C10H22N2OS2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-[2-(2-methoxyethyldisulfanyl)ethyl]-4-methylpiperazine.
| Compound Name | 1-[2-(2-methoxyethyldisulfanyl)ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 134517104 |
| Molecular Formula | C10H22N2OS2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-[2-(2-methoxyethyldisulfanyl)ethyl]-4-methylpiperazine |
| SMILES | COCCSSCCN1CCN(C)CC1 |
| InChI | InChI=1S/C10H22N2OS2/c1-11-3-5-12(6-4-11)7-9-14-15-10-8-13-2/h3-10H2,1-2H3 |
| InChIKey | WTUSQZSTGBLHBM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|