C20H24N5O3S- — CID 134520711
[3-[[6-[[(1R,2S)-2-aminocyclohexyl]amino]-3-oxo-1,2-dihydropyrrolo[3,4-c]pyridin-4-yl]amino]phenyl]methanesulfinate (PubChem CID 134520711) has the molecular formula C20H24N5O3S- and a molecular weight of 414.51 g/mol. Its IUPAC name is [3-[[6-[[(1R,2S)-2-aminocyclohexyl]amino]-3-oxo-1,2-dihydropyrrolo[3,4-c]pyridin-4-yl]amino]phenyl]methanesulfinate.
| Compound Name | [3-[[6-[[(1R,2S)-2-aminocyclohexyl]amino]-3-oxo-1,2-dihydropyrrolo[3,4-c]pyridin-4-yl]amino]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 134520711 |
| Molecular Formula | C20H24N5O3S- |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [3-[[6-[[(1R,2S)-2-aminocyclohexyl]amino]-3-oxo-1,2-dihydropyrrolo[3,4-c]pyridin-4-yl]amino]phenyl]methanesulfinate |
| SMILES | N[C@H]1CCCC[C@H]1Nc1cc2c(c(Nc3cccc(CS(=O)[O-])c3)n1)C(=O)NC2 |
| InChI | InChI=1S/C20H25N5O3S/c21-15-6-1-2-7-16(15)24-17-9-13-10-22-20(26)18(13)19(25-17)23-14-5-3-4-12(8-14)11-29(27)28/h3-5,8-9,15-16H,1-2,6-7,10-11,21H2,(H,22,26)(H,27,28)(H2,23,24,25)/p-1/t15-,16+/m0/s1 |
| InChIKey | ONNRYCJUZIWEFA-JKSUJKDBSA-M |
| XLogP | 2.13 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|