C20H23N5O3S — CID 163655540
6-[[(2S)-2-aminocyclohexylidene]amino]-4-(3-methylsulfonylanilino)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 163655540) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 6-[[(2S)-2-aminocyclohexylidene]amino]-4-(3-methylsulfonylanilino)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 6-[[(2S)-2-aminocyclohexylidene]amino]-4-(3-methylsulfonylanilino)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 163655540 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 6-[[(2S)-2-aminocyclohexylidene]amino]-4-(3-methylsulfonylanilino)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | CS(=O)(=O)c1cccc(Nc2nc(/N=C3\CCCC[C@@H]3N)cc3c2C(=O)NC3)c1 |
| InChI | InChI=1S/C20H23N5O3S/c1-29(27,28)14-6-4-5-13(10-14)23-19-18-12(11-22-20(18)26)9-17(25-19)24-16-8-3-2-7-15(16)21/h4-6,9-10,15H,2-3,7-8,11,21H2,1H3,(H,22,26)(H,23,25)/b24-16+/t15-/m0/s1 |
| InChIKey | IPXINDQYVGGCEE-HXNWEGJNSA-N |
| XLogP | 2.45 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|