C27H29N7O3S3 — CID 158193574
6-[[(1S,2R)-2-aminocyclohexyl]amino]-4-[[2-(5-morpholin-4-yl-7-oxothieno[3,2-b]thiopyran-3-yl)-1,3-thiazol-5-yl]amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 158193574) has the molecular formula C27H29N7O3S3 and a molecular weight of 595.78 g/mol. Its IUPAC name is 6-[[(1S,2R)-2-aminocyclohexyl]amino]-4-[[2-(5-morpholin-4-yl-7-oxothieno[3,2-b]thiopyran-3-yl)-1,3-thiazol-5-yl]amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 6-[[(1S,2R)-2-aminocyclohexyl]amino]-4-[[2-(5-morpholin-4-yl-7-oxothieno[3,2-b]thiopyran-3-yl)-1,3-thiazol-5-yl]amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 158193574 |
| Molecular Formula | C27H29N7O3S3 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 6-[[(1S,2R)-2-aminocyclohexyl]amino]-4-[[2-(5-morpholin-4-yl-7-oxothieno[3,2-b]thiopyran-3-yl)-1,3-thiazol-5-yl]amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | N[C@@H]1CCCC[C@@H]1Nc1cc2c(c(Nc3cnc(-c4csc5c(=O)cc(N6CCOCC6)sc45)s3)n1)C(=O)NC2 |
| InChI | InChI=1S/C27H29N7O3S3/c28-16-3-1-2-4-17(16)31-19-9-14-11-29-26(36)22(14)25(32-19)33-20-12-30-27(39-20)15-13-38-24-18(35)10-21(40-23(15)24)34-5-7-37-8-6-34/h9-10,12-13,16-17H,1-8,11,28H2,(H,29,36)(H2,31,32,33)/t16-,17+/m1/s1 |
| InChIKey | GABHVSZMZIJKMP-SJORKVTESA-N |
| XLogP | 4.35 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |