C23H29N7O — CID 141298855
2-N-[(1R,2S)-2-aminocyclohexyl]-4-N-(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidine-2,4-diamine (PubChem CID 141298855) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-N-[(1R,2S)-2-aminocyclohexyl]-4-N-(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(1R,2S)-2-aminocyclohexyl]-4-N-(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141298855 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2-N-[(1R,2S)-2-aminocyclohexyl]-4-N-(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidine-2,4-diamine |
| SMILES | N[C@H]1CCCC[C@H]1Nc1nc(Nc2ccc(N3CCOCC3)cc2)c2cnccc2n1 |
| InChI | InChI=1S/C23H29N7O/c24-19-3-1-2-4-21(19)28-23-27-20-9-10-25-15-18(20)22(29-23)26-16-5-7-17(8-6-16)30-11-13-31-14-12-30/h5-10,15,19,21H,1-4,11-14,24H2,(H2,26,27,28,29)/t19-,21+/m0/s1 |
| InChIKey | WZRDOWYHPAMGIG-PZJWPPBQSA-N |
| XLogP | 3.29 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|