About ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate
ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate (PubChem CID 134521175) has the molecular formula C18H33NO4
and a molecular weight of 327.47 g/mol. Its IUPAC name is ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate |
| PubChem CID | 134521175 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate |
| SMILES | CCOC(=O)CC(N(C(=O)OCC)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C18H33NO4/c1-6-22-16(20)13-15(18(3,4)5)19(17(21)23-7-2)14-11-9-8-10-12-14/h14-15H,6-13H2,1-5H3 |
| InChIKey | JRLLNPLFHKPUTR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate?
The IUPAC name of ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate (CID 134521175) is ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate.
What is the SMILES notation for ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate?
The canonical SMILES for ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate is CCOC(=O)CC(N(C(=O)OCC)C1CCCCC1)C(C)(C)C.
What is the InChIKey of ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate?
The InChIKey is JRLLNPLFHKPUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO4/c1-6-22-16(20)13-15(18(3,4)5)19(17(21)23-7-2)14-11-9-8-10-12-14/h14-15H,6-13H2,1-5H3.
What are the key properties of ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate?
ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate has a molecular weight of 327.47 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[cyclohexyl(ethoxycarbonyl)amino]-4,4-dimethylpentanoate is sourced from PubChem (CID 134521175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).