C24H39N3O2 — CID 134523801
(2R)-2-[(2-benzyl-2-azaspiro[4.5]decan-8-yl)amino]-6-(dimethylamino)hexanoic acid (PubChem CID 134523801) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is (2R)-2-[(2-benzyl-2-azaspiro[4.5]decan-8-yl)amino]-6-(dimethylamino)hexanoic acid.
| Compound Name | (2R)-2-[(2-benzyl-2-azaspiro[4.5]decan-8-yl)amino]-6-(dimethylamino)hexanoic acid |
|---|---|
| PubChem CID | 134523801 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | (2R)-2-[(2-benzyl-2-azaspiro[4.5]decan-8-yl)amino]-6-(dimethylamino)hexanoic acid |
| SMILES | CN(C)CCCC[C@@H](NC1CCC2(CC1)CCN(Cc1ccccc1)C2)C(=O)O |
| InChI | InChI=1S/C24H39N3O2/c1-26(2)16-7-6-10-22(23(28)29)25-21-11-13-24(14-12-21)15-17-27(19-24)18-20-8-4-3-5-9-20/h3-5,8-9,21-22,25H,6-7,10-19H2,1-2H3,(H,28,29)/t21?,22-,24?/m1/s1 |
| InChIKey | YUWPEOBKUPFSPU-XERBYJISSA-N |
| XLogP | 3.60 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|