C26H42N4 — CID 134525507
N-cyclopentyl-2-methanimidoyl-3-(2-methylpropyl)-5-(1-piperidin-4-ylpiperidin-4-yl)aniline (PubChem CID 134525507) has the molecular formula C26H42N4 and a molecular weight of 410.65 g/mol. Its IUPAC name is N-cyclopentyl-2-methanimidoyl-3-(2-methylpropyl)-5-(1-piperidin-4-ylpiperidin-4-yl)aniline.
| Compound Name | N-cyclopentyl-2-methanimidoyl-3-(2-methylpropyl)-5-(1-piperidin-4-ylpiperidin-4-yl)aniline |
|---|---|
| PubChem CID | 134525507 |
| Molecular Formula | C26H42N4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | N-cyclopentyl-2-methanimidoyl-3-(2-methylpropyl)-5-(1-piperidin-4-ylpiperidin-4-yl)aniline |
| SMILES | [H]/N=C/c1c(CC(C)C)cc(C2CCN(C3CCNCC3)CC2)cc1NC1CCCC1 |
| InChI | InChI=1S/C26H42N4/c1-19(2)15-22-16-21(17-26(25(22)18-27)29-23-5-3-4-6-23)20-9-13-30(14-10-20)24-7-11-28-12-8-24/h16-20,23-24,27-29H,3-15H2,1-2H3/b27-18+ |
| InChIKey | VZJFQCLRAOJBGN-OVVQPSECSA-N |
| XLogP | 5.17 |
| TPSA | 51.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|