C24H39N3 — CID 134525735
N-cyclopentyl-5-(1-hexan-3-ylpiperidin-4-yl)-2-methanimidoyl-3-methylaniline (PubChem CID 134525735) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is N-cyclopentyl-5-(1-hexan-3-ylpiperidin-4-yl)-2-methanimidoyl-3-methylaniline.
| Compound Name | N-cyclopentyl-5-(1-hexan-3-ylpiperidin-4-yl)-2-methanimidoyl-3-methylaniline |
|---|---|
| PubChem CID | 134525735 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | N-cyclopentyl-5-(1-hexan-3-ylpiperidin-4-yl)-2-methanimidoyl-3-methylaniline |
| SMILES | [H]/N=C/c1c(C)cc(C2CCN(C(CC)CCC)CC2)cc1NC1CCCC1 |
| InChI | InChI=1S/C24H39N3/c1-4-8-22(5-2)27-13-11-19(12-14-27)20-15-18(3)23(17-25)24(16-20)26-21-9-6-7-10-21/h15-17,19,21-22,25-26H,4-14H2,1-3H3/b25-17+ |
| InChIKey | AQMORMTZMIQVDD-KOEQRZSOSA-N |
| XLogP | 6.11 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|