C20H25N3O2 — CID 155014628
3-methanimidoyl-6-methyl-1-[(4-methylphenyl)methyl]-4-(oxan-4-ylamino)pyridin-2-one (PubChem CID 155014628) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-methanimidoyl-6-methyl-1-[(4-methylphenyl)methyl]-4-(oxan-4-ylamino)pyridin-2-one.
| Compound Name | 3-methanimidoyl-6-methyl-1-[(4-methylphenyl)methyl]-4-(oxan-4-ylamino)pyridin-2-one |
|---|---|
| PubChem CID | 155014628 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-methanimidoyl-6-methyl-1-[(4-methylphenyl)methyl]-4-(oxan-4-ylamino)pyridin-2-one |
| SMILES | [H]/N=C/c1c(NC2CCOCC2)cc(C)n(Cc2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C20H25N3O2/c1-14-3-5-16(6-4-14)13-23-15(2)11-19(18(12-21)20(23)24)22-17-7-9-25-10-8-17/h3-6,11-12,17,21-22H,7-10,13H2,1-2H3/b21-12+ |
| InChIKey | DOECJWYQEVOGRB-CIAFOILYSA-N |
| XLogP | 3.10 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|