C34H43N — CID 134526530
2,4-bis(3,4-dimethylphenyl)-6-ethenyl-3-methyl-5-(2,5,5-trimethylhex-1-en-3-yl)aniline (PubChem CID 134526530) has the molecular formula C34H43N and a molecular weight of 465.73 g/mol. Its IUPAC name is 2,4-bis(3,4-dimethylphenyl)-6-ethenyl-3-methyl-5-(2,5,5-trimethylhex-1-en-3-yl)aniline.
| Compound Name | 2,4-bis(3,4-dimethylphenyl)-6-ethenyl-3-methyl-5-(2,5,5-trimethylhex-1-en-3-yl)aniline |
|---|---|
| PubChem CID | 134526530 |
| Molecular Formula | C34H43N |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | 2,4-bis(3,4-dimethylphenyl)-6-ethenyl-3-methyl-5-(2,5,5-trimethylhex-1-en-3-yl)aniline |
| SMILES | C=Cc1c(N)c(-c2ccc(C)c(C)c2)c(C)c(-c2ccc(C)c(C)c2)c1C(CC(C)(C)C)C(=C)C |
| InChI | InChI=1S/C34H43N/c1-12-28-32(29(20(2)3)19-34(9,10)11)30(26-15-13-21(4)23(6)17-26)25(8)31(33(28)35)27-16-14-22(5)24(7)18-27/h12-18,29H,1-2,19,35H2,3-11H3 |
| InChIKey | IVAPJZDCFQOYHO-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|