C25H24N2OS — CID 134526845
6-methyl-2-[5-(4-methylidene-3H-quinolin-2-yl)thiophen-2-yl]-5-(prop-2-enylideneamino)hepta-1,5-dien-4-one (PubChem CID 134526845) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 6-methyl-2-[5-(4-methylidene-3H-quinolin-2-yl)thiophen-2-yl]-5-(prop-2-enylideneamino)hepta-1,5-dien-4-one.
| Compound Name | 6-methyl-2-[5-(4-methylidene-3H-quinolin-2-yl)thiophen-2-yl]-5-(prop-2-enylideneamino)hepta-1,5-dien-4-one |
|---|---|
| PubChem CID | 134526845 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 6-methyl-2-[5-(4-methylidene-3H-quinolin-2-yl)thiophen-2-yl]-5-(prop-2-enylideneamino)hepta-1,5-dien-4-one |
| SMILES | C=C/C=N/C(C(=O)CC(=C)c1ccc(C2=Nc3ccccc3C(=C)C2)s1)=C(C)C |
| InChI | InChI=1S/C25H24N2OS/c1-6-13-26-25(16(2)3)22(28)15-18(5)23-11-12-24(29-23)21-14-17(4)19-9-7-8-10-20(19)27-21/h6-13H,1,4-5,14-15H2,2-3H3/b26-13+ |
| InChIKey | FLDQYVVQFUGFBC-LGJNPRDNSA-N |
| XLogP | 6.81 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|