C7H9F6N — CID 134531029
1,2,2-trifluoro-N,3-dimethyl-N-(trifluoromethyl)but-3-en-1-amine (PubChem CID 134531029) has the molecular formula C7H9F6N and a molecular weight of 221.14 g/mol. Its IUPAC name is 1,2,2-trifluoro-N,3-dimethyl-N-(trifluoromethyl)but-3-en-1-amine.
| Compound Name | 1,2,2-trifluoro-N,3-dimethyl-N-(trifluoromethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 134531029 |
| Molecular Formula | C7H9F6N |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1,2,2-trifluoro-N,3-dimethyl-N-(trifluoromethyl)but-3-en-1-amine |
| SMILES | C=C(C)C(F)(F)C(F)N(C)C(F)(F)F |
| InChI | InChI=1S/C7H9F6N/c1-4(2)6(9,10)5(8)14(3)7(11,12)13/h5H,1H2,2-3H3 |
| InChIKey | NPLVOIUIJLLXEO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|