C8H9F8N — CID 134531068
1,1,1,3,3-pentafluoro-N,4-dimethyl-N-(trifluoromethyl)pent-4-en-2-amine (PubChem CID 134531068) has the molecular formula C8H9F8N and a molecular weight of 271.15 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-N,4-dimethyl-N-(trifluoromethyl)pent-4-en-2-amine.
| Compound Name | 1,1,1,3,3-pentafluoro-N,4-dimethyl-N-(trifluoromethyl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 134531068 |
| Molecular Formula | C8H9F8N |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-N,4-dimethyl-N-(trifluoromethyl)pent-4-en-2-amine |
| SMILES | C=C(C)C(F)(F)C(N(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F8N/c1-4(2)6(9,10)5(7(11,12)13)17(3)8(14,15)16/h5H,1H2,2-3H3 |
| InChIKey | TVGNEQVNAMNMDH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|