C11H22FN — CID 170950702
(2R)-N-(2-fluoro-2-methylpropyl)-N,4-dimethylpent-4-en-2-amine (PubChem CID 170950702) has the molecular formula C11H22FN and a molecular weight of 187.30 g/mol. Its IUPAC name is (2R)-N-(2-fluoro-2-methylpropyl)-N,4-dimethylpent-4-en-2-amine.
| Compound Name | (2R)-N-(2-fluoro-2-methylpropyl)-N,4-dimethylpent-4-en-2-amine |
|---|---|
| PubChem CID | 170950702 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | (2R)-N-(2-fluoro-2-methylpropyl)-N,4-dimethylpent-4-en-2-amine |
| SMILES | C=C(C)C[C@@H](C)N(C)CC(C)(C)F |
| InChI | InChI=1S/C11H22FN/c1-9(2)7-10(3)13(6)8-11(4,5)12/h10H,1,7-8H2,2-6H3/t10-/m1/s1 |
| InChIKey | DOVUUONJSVHNPV-SNVBAGLBSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|