C9H16F3N — CID 146266978
(2R)-N,4-dimethyl-N-(2,2,2-trifluoroethyl)pent-4-en-2-amine (PubChem CID 146266978) has the molecular formula C9H16F3N and a molecular weight of 195.23 g/mol. Its IUPAC name is (2R)-N,4-dimethyl-N-(2,2,2-trifluoroethyl)pent-4-en-2-amine.
| Compound Name | (2R)-N,4-dimethyl-N-(2,2,2-trifluoroethyl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 146266978 |
| Molecular Formula | C9H16F3N |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | (2R)-N,4-dimethyl-N-(2,2,2-trifluoroethyl)pent-4-en-2-amine |
| SMILES | C=C(C)C[C@@H](C)N(C)CC(F)(F)F |
| InChI | InChI=1S/C9H16F3N/c1-7(2)5-8(3)13(4)6-9(10,11)12/h8H,1,5-6H2,2-4H3/t8-/m1/s1 |
| InChIKey | HPWYJXUJXWKOMR-MRVPVSSYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|