C12H22F3N — CID 146266976
(E,2R)-4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)hept-4-en-2-amine (PubChem CID 146266976) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is (E,2R)-4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)hept-4-en-2-amine.
| Compound Name | (E,2R)-4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)hept-4-en-2-amine |
|---|---|
| PubChem CID | 146266976 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (E,2R)-4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)hept-4-en-2-amine |
| SMILES | CC/C=C(\CC)C[C@@H](C)N(C)CC(F)(F)F |
| InChI | InChI=1S/C12H22F3N/c1-5-7-11(6-2)8-10(3)16(4)9-12(13,14)15/h7,10H,5-6,8-9H2,1-4H3/b11-7+/t10-/m1/s1 |
| InChIKey | AGXJQXJICNDFOM-UEUZTHOGSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|