C11H14F7N — CID 147280269
2-fluoro-2-(trifluoromethyl)-1-(1,2,3-trifluoro-4-methylpent-4-enyl)pyrrolidine (PubChem CID 147280269) has the molecular formula C11H14F7N and a molecular weight of 293.23 g/mol. Its IUPAC name is 2-fluoro-2-(trifluoromethyl)-1-(1,2,3-trifluoro-4-methylpent-4-enyl)pyrrolidine.
| Compound Name | 2-fluoro-2-(trifluoromethyl)-1-(1,2,3-trifluoro-4-methylpent-4-enyl)pyrrolidine |
|---|---|
| PubChem CID | 147280269 |
| Molecular Formula | C11H14F7N |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-fluoro-2-(trifluoromethyl)-1-(1,2,3-trifluoro-4-methylpent-4-enyl)pyrrolidine |
| SMILES | C=C(C)C(F)C(F)C(F)N1CCCC1(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F7N/c1-6(2)7(12)8(13)9(14)19-5-3-4-10(19,15)11(16,17)18/h7-9H,1,3-5H2,2H3 |
| InChIKey | CSDZFKPVNHJLGL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|