C19H19Cl2NO5S — CID 134536931
2-[(2R,4aR,5S,6R,7aS)-5-[(2,5-dichlorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 134536931) has the molecular formula C19H19Cl2NO5S and a molecular weight of 444.34 g/mol. Its IUPAC name is 2-[(2R,4aR,5S,6R,7aS)-5-[(2,5-dichlorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(2R,4aR,5S,6R,7aS)-5-[(2,5-dichlorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 134536931 |
| Molecular Formula | C19H19Cl2NO5S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 2-[(2R,4aR,5S,6R,7aS)-5-[(2,5-dichlorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc([C@H]2CC[C@@H]3[C@@H](COc4cc(Cl)ccc4Cl)[C@H](O)C[C@@H]3O2)n1 |
| InChI | InChI=1S/C19H19Cl2NO5S/c20-9-1-3-12(21)17(5-9)26-7-11-10-2-4-15(27-16(10)6-14(11)23)18-22-13(8-28-18)19(24)25/h1,3,5,8,10-11,14-16,23H,2,4,6-7H2,(H,24,25)/t10-,11-,14-,15-,16+/m1/s1 |
| InChIKey | KIQXBFKYCMXWPM-YWCGQCRUSA-N |
| XLogP | 4.44 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |