C21H24FNO5S — CID 140766131
2-[(2R,4aR,5S,6S,7aS)-5-[(4-ethyl-3-fluorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 140766131) has the molecular formula C21H24FNO5S and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-[(2R,4aR,5S,6S,7aS)-5-[(4-ethyl-3-fluorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(2R,4aR,5S,6S,7aS)-5-[(4-ethyl-3-fluorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 140766131 |
| Molecular Formula | C21H24FNO5S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[(2R,4aR,5S,6S,7aS)-5-[(4-ethyl-3-fluorophenoxy)methyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCc1ccc(OC[C@@H]2[C@H]3CC[C@H](c4nc(C(=O)O)cs4)O[C@H]3C[C@@H]2O)cc1F |
| InChI | InChI=1S/C21H24FNO5S/c1-2-11-3-4-12(7-15(11)22)27-9-14-13-5-6-18(28-19(13)8-17(14)24)20-23-16(10-29-20)21(25)26/h3-4,7,10,13-14,17-19,24H,2,5-6,8-9H2,1H3,(H,25,26)/t13-,14-,17+,18-,19+/m1/s1 |
| InChIKey | MUTPPGPPFAJASQ-WTWWFLFCSA-N |
| XLogP | 3.84 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |