C20H24ClNO4S — CID 140766221
(2R,4aR,5S,6S,7aS)-5-[(4-chloro-3-methylphenoxy)methyl]-2-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-ol (PubChem CID 140766221) has the molecular formula C20H24ClNO4S and a molecular weight of 409.94 g/mol. Its IUPAC name is (2R,4aR,5S,6S,7aS)-5-[(4-chloro-3-methylphenoxy)methyl]-2-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-ol.
| Compound Name | (2R,4aR,5S,6S,7aS)-5-[(4-chloro-3-methylphenoxy)methyl]-2-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-ol |
|---|---|
| PubChem CID | 140766221 |
| Molecular Formula | C20H24ClNO4S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2R,4aR,5S,6S,7aS)-5-[(4-chloro-3-methylphenoxy)methyl]-2-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-ol |
| SMILES | Cc1cc(OC[C@@H]2[C@H]3CC[C@H](c4nc(CO)cs4)O[C@H]3C[C@@H]2O)ccc1Cl |
| InChI | InChI=1S/C20H24ClNO4S/c1-11-6-13(2-4-16(11)21)25-9-15-14-3-5-18(26-19(14)7-17(15)24)20-22-12(8-23)10-27-20/h2,4,6,10,14-15,17-19,23-24H,3,5,7-9H2,1H3/t14-,15-,17+,18-,19+/m1/s1 |
| InChIKey | LGWORWZSJMHXDA-FDMITFGQSA-N |
| XLogP | 3.89 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |