C32H41NO5SSi — CID 140766195
propan-2-yl 2-[(2R,4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 140766195) has the molecular formula C32H41NO5SSi and a molecular weight of 579.84 g/mol. Its IUPAC name is propan-2-yl 2-[(2R,4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | propan-2-yl 2-[(2R,4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 140766195 |
| Molecular Formula | C32H41NO5SSi |
| Molecular Weight | 579.84 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | propan-2-yl 2-[(2R,4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)OC(=O)c1csc([C@H]2CC[C@@H]3[C@@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)[C@H](O)C[C@@H]3O2)n1 |
| InChI | InChI=1S/C32H41NO5SSi/c1-21(2)37-31(35)26-20-39-30(33-26)28-17-16-24-25(27(34)18-29(24)38-28)19-36-40(32(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,20-21,24-25,27-29,34H,16-19H2,1-5H3/t24-,25-,27-,28-,29+/m1/s1 |
| InChIKey | XEPVZWXVECXAOJ-KFRZBYBZSA-N |
| XLogP | 5.50 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.84 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|