C17H13FN4O3 — CID 134538304
4-[2-fluoro-5-(2-methylprop-2-enoylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid (PubChem CID 134538304) has the molecular formula C17H13FN4O3 and a molecular weight of 340.31 g/mol. Its IUPAC name is 4-[2-fluoro-5-(2-methylprop-2-enoylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[2-fluoro-5-(2-methylprop-2-enoylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 134538304 |
| Molecular Formula | C17H13FN4O3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-[2-fluoro-5-(2-methylprop-2-enoylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
| SMILES | C=C(C)C(=O)Nc1ccc(F)c(-c2ncnc3[nH]cc(C(=O)O)c23)c1 |
| InChI | InChI=1S/C17H13FN4O3/c1-8(2)16(23)22-9-3-4-12(18)10(5-9)14-13-11(17(24)25)6-19-15(13)21-7-20-14/h3-7H,1H2,2H3,(H,22,23)(H,24,25)(H,19,20,21) |
| InChIKey | CDQFNRSRIXDYEK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|